C18H19N3O3 — CID 50965624
N-(4,7-dimethyl-2-oxochromen-6-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 50965624) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(4,7-dimethyl-2-oxochromen-6-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(4,7-dimethyl-2-oxochromen-6-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 50965624 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-(4,7-dimethyl-2-oxochromen-6-yl)-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc2oc(=O)cc(C)c2cc1NC(=O)c1cc(C(C)C)[nH]n1 |
| InChI | InChI=1S/C18H19N3O3/c1-9(2)13-8-15(21-20-13)18(23)19-14-7-12-10(3)6-17(22)24-16(12)5-11(14)4/h5-9H,1-4H3,(H,19,23)(H,20,21) |
| InChIKey | UHQBGVBGFJOSRW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|