2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid

C13H11NO5 — CID 12906975

IUPAC2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid
SMILESCc1cc2c(C)cc(=O)oc2cc1NC(=O)C(=O)O
InChIInChI=1S/C13H11NO5/c1-6-4-11(15)19-10-5-9(7(2)3-8(6)10)14-12(16)13(17)18/h3-5H,1-2H3,(H,14,16)(H,17,18)
InChIKeyDFKAUBAZXBMRON-UHFFFAOYSA-N
MW261.23 g/mol
LogP1.43
Rot. Bonds1

About 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid

2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid (PubChem CID 12906975) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid.

Molecular Properties

Compound Name2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid
PubChem CID12906975
Molecular FormulaC13H11NO5
Molecular Weight261.23 g/mol
Exact Mass261.06
IUPAC Name2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid
SMILESCc1cc2c(C)cc(=O)oc2cc1NC(=O)C(=O)O
InChIInChI=1S/C13H11NO5/c1-6-4-11(15)19-10-5-9(7(2)3-8(6)10)14-12(16)13(17)18/h3-5H,1-2H3,(H,14,16)(H,17,18)
InChIKeyDFKAUBAZXBMRON-UHFFFAOYSA-N
XLogP1.43
TPSA96.61 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.23
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid?
The IUPAC name of 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid (CID 12906975) is 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid.
What is the SMILES notation for 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid?
The canonical SMILES for 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid is Cc1cc2c(C)cc(=O)oc2cc1NC(=O)C(=O)O.
What is the InChIKey of 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid?
The InChIKey is DFKAUBAZXBMRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO5/c1-6-4-11(15)19-10-5-9(7(2)3-8(6)10)14-12(16)13(17)18/h3-5H,1-2H3,(H,14,16)(H,17,18).
What are the key properties of 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid?
2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid has a molecular weight of 261.23 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid is sourced from PubChem (CID 12906975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).