C13H11NO5 — CID 12906975
2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid (PubChem CID 12906975) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid.
| Compound Name | 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 12906975 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[(4,6-dimethyl-2-oxochromen-7-yl)amino]-2-oxoacetic acid |
| SMILES | Cc1cc2c(C)cc(=O)oc2cc1NC(=O)C(=O)O |
| InChI | InChI=1S/C13H11NO5/c1-6-4-11(15)19-10-5-9(7(2)3-8(6)10)14-12(16)13(17)18/h3-5H,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | DFKAUBAZXBMRON-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|