C12H10O3 — CID 91872203
4-methyl-6,8-dihydrofuro[3,4-g]chromen-2-one (PubChem CID 91872203) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-methyl-6,8-dihydrofuro[3,4-g]chromen-2-one.
| Compound Name | 4-methyl-6,8-dihydrofuro[3,4-g]chromen-2-one |
|---|---|
| PubChem CID | 91872203 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4-methyl-6,8-dihydrofuro[3,4-g]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc3c(cc12)COC3 |
| InChI | InChI=1S/C12H10O3/c1-7-2-12(13)15-11-4-9-6-14-5-8(9)3-10(7)11/h2-4H,5-6H2,1H3 |
| InChIKey | UJDLIAVJKMFVEP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|