C21H23ClN2O4 — CID 172897097
2-(2-aminoethoxy)-N-(4,7-dimethyl-2-oxochromen-6-yl)-5-methylbenzamide;hydrochloride (PubChem CID 172897097) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(4,7-dimethyl-2-oxochromen-6-yl)-5-methylbenzamide;hydrochloride.
| Compound Name | 2-(2-aminoethoxy)-N-(4,7-dimethyl-2-oxochromen-6-yl)-5-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 172897097 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(4,7-dimethyl-2-oxochromen-6-yl)-5-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(OCCN)c(C(=O)Nc2cc3c(C)cc(=O)oc3cc2C)c1.Cl |
| InChI | InChI=1S/C21H22N2O4.ClH/c1-12-4-5-18(26-7-6-22)16(8-12)21(25)23-17-11-15-13(2)10-20(24)27-19(15)9-14(17)3;/h4-5,8-11H,6-7,22H2,1-3H3,(H,23,25);1H |
| InChIKey | NWXFKCXBIAXTHU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|