C20H25F3N4O — CID 123413635
1-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-2-methylpropan-2-ol (PubChem CID 123413635) has the molecular formula C20H25F3N4O and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-2-methylpropan-2-ol.
| Compound Name | 1-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 123413635 |
| Molecular Formula | C20H25F3N4O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-[3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-2-methylpropan-2-ol |
| SMILES | CCC1CC(CC(C)(C)O)CC1c1nc(C(F)(F)F)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C20H25F3N4O/c1-4-12-7-11(9-19(2,3)28)8-13(12)18-26-16(20(21,22)23)15-10-25-17-14(27(15)18)5-6-24-17/h5-6,10-13,24,28H,4,7-9H2,1-3H3 |
| InChIKey | KIAWOUOMXIGIOR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |