C11H14N2O2 — CID 123414627
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]prop-2-enamide (PubChem CID 123414627) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]prop-2-enamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123414627 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C11H14N2O2/c1-4-10(14)12-6-9-7(2)5-8(3)13-11(9)15/h4-5H,1,6H2,2-3H3,(H,12,14)(H,13,15) |
| InChIKey | PUGPWTKBQGMQCN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|