C12H18N2O2 — CID 139584912
(E,4S)-4-[[(2Z,4E)-hexa-2,4-dienoyl]amino]-2-methylpent-2-enamide (PubChem CID 139584912) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (E,4S)-4-[[(2Z,4E)-hexa-2,4-dienoyl]amino]-2-methylpent-2-enamide.
| Compound Name | (E,4S)-4-[[(2Z,4E)-hexa-2,4-dienoyl]amino]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 139584912 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (E,4S)-4-[[(2Z,4E)-hexa-2,4-dienoyl]amino]-2-methylpent-2-enamide |
| SMILES | C/C=C/C=C\C(=O)N[C@@H](C)/C=C(\C)C(N)=O |
| InChI | InChI=1S/C12H18N2O2/c1-4-5-6-7-11(15)14-10(3)8-9(2)12(13)16/h4-8,10H,1-3H3,(H2,13,16)(H,14,15)/b5-4+,7-6-,9-8+/t10-/m0/s1 |
| InChIKey | RLRAXUHUWIIGIW-MSZNJUQXSA-N |
| XLogP | 1.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|