C21H44 — CID 123414725
5-ethyl-3,4,5-trimethyl-6-propan-2-yltridecane (PubChem CID 123414725) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 5-ethyl-3,4,5-trimethyl-6-propan-2-yltridecane.
| Compound Name | 5-ethyl-3,4,5-trimethyl-6-propan-2-yltridecane |
|---|---|
| PubChem CID | 123414725 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 5-ethyl-3,4,5-trimethyl-6-propan-2-yltridecane |
| SMILES | CCCCCCCC(C(C)C)C(C)(CC)C(C)C(C)CC |
| InChI | InChI=1S/C21H44/c1-9-12-13-14-15-16-20(17(4)5)21(8,11-3)19(7)18(6)10-2/h17-20H,9-16H2,1-8H3 |
| InChIKey | YMXKVZIBJOCWQU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|