C28H58 — CID 123557975
7-(3-ethyl-3,4,5-trimethylhexan-2-yl)-8-methylhexadecane (PubChem CID 123557975) has the molecular formula C28H58 and a molecular weight of 394.77 g/mol. Its IUPAC name is 7-(3-ethyl-3,4,5-trimethylhexan-2-yl)-8-methylhexadecane.
| Compound Name | 7-(3-ethyl-3,4,5-trimethylhexan-2-yl)-8-methylhexadecane |
|---|---|
| PubChem CID | 123557975 |
| Molecular Formula | C28H58 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.45 |
| IUPAC Name | 7-(3-ethyl-3,4,5-trimethylhexan-2-yl)-8-methylhexadecane |
| SMILES | CCCCCCCCC(C)C(CCCCCC)C(C)C(C)(CC)C(C)C(C)C |
| InChI | InChI=1S/C28H58/c1-10-13-15-17-18-19-21-24(6)27(22-20-16-14-11-2)26(8)28(9,12-3)25(7)23(4)5/h23-27H,10-22H2,1-9H3 |
| InChIKey | JWJVEMMDVRKGDY-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|