C14H26 — CID 123414823
1-(cyclobutylmethyl)-2,3,4-trimethylcyclohexane (PubChem CID 123414823) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2,3,4-trimethylcyclohexane.
| Compound Name | 1-(cyclobutylmethyl)-2,3,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 123414823 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1-(cyclobutylmethyl)-2,3,4-trimethylcyclohexane |
| SMILES | CC1CCC(CC2CCC2)C(C)C1C |
| InChI | InChI=1S/C14H26/c1-10-7-8-14(12(3)11(10)2)9-13-5-4-6-13/h10-14H,4-9H2,1-3H3 |
| InChIKey | SAFYNLIMZMFMTJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |