C17H28F2 — CID 143761329
1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane (PubChem CID 143761329) has the molecular formula C17H28F2 and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane.
| Compound Name | 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane |
|---|---|
| PubChem CID | 143761329 |
| Molecular Formula | C17H28F2 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane |
| SMILES | C=CC1CCCC(CC2CCC(C)C(F)C2F)CC1 |
| InChI | InChI=1S/C17H28F2/c1-3-13-5-4-6-14(9-8-13)11-15-10-7-12(2)16(18)17(15)19/h3,12-17H,1,4-11H2,2H3 |
| InChIKey | HKYOGKPGKMBRSM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|