About 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane
1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane (PubChem CID 143761329) has the molecular formula C17H28F2
and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane.
Molecular Properties
| Compound Name | 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane |
| PubChem CID | 143761329 |
| Molecular Formula | C17H28F2 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane |
| SMILES | C=CC1CCCC(CC2CCC(C)C(F)C2F)CC1 |
| InChI | InChI=1S/C17H28F2/c1-3-13-5-4-6-14(9-8-13)11-15-10-7-12(2)16(18)17(15)19/h3,12-17H,1,4-11H2,2H3 |
| InChIKey | HKYOGKPGKMBRSM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane?
The IUPAC name of 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane (CID 143761329) is 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane.
What is the SMILES notation for 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane?
The canonical SMILES for 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane is C=CC1CCCC(CC2CCC(C)C(F)C2F)CC1.
What is the InChIKey of 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane?
The InChIKey is HKYOGKPGKMBRSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28F2/c1-3-13-5-4-6-14(9-8-13)11-15-10-7-12(2)16(18)17(15)19/h3,12-17H,1,4-11H2,2H3.
What are the key properties of 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane?
1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane has a molecular weight of 270.41 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-difluoro-4-methylcyclohexyl)methyl]-4-ethenylcycloheptane is sourced from PubChem (CID 143761329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).