C25H23F2N5O2S — CID 123415027
1-[3-[2-(diethylamino)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea (PubChem CID 123415027) has the molecular formula C25H23F2N5O2S and a molecular weight of 495.56 g/mol. Its IUPAC name is 1-[3-[2-(diethylamino)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea.
| Compound Name | 1-[3-[2-(diethylamino)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 123415027 |
| Molecular Formula | C25H23F2N5O2S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 1-[3-[2-(diethylamino)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-3-(2,4-difluorophenyl)-1-hydroxyurea |
| SMILES | CCN(CC)c1nc(-c2ccncc2)c(-c2cccc(N(O)C(=O)Nc3ccc(F)cc3F)c2)s1 |
| InChI | InChI=1S/C25H23F2N5O2S/c1-3-31(4-2)25-30-22(16-10-12-28-13-11-16)23(35-25)17-6-5-7-19(14-17)32(34)24(33)29-21-9-8-18(26)15-20(21)27/h5-15,34H,3-4H2,1-2H3,(H,29,33) |
| InChIKey | GRXBBGNVQBDIDT-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|