About [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate
[butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate (PubChem CID 123421345) has the molecular formula C16H23FO3Si
and a molecular weight of 310.44 g/mol. Its IUPAC name is [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate.
Molecular Properties
| Compound Name | [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate |
| PubChem CID | 123421345 |
| Molecular Formula | C16H23FO3Si |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate |
| SMILES | CCCC[Si](C)(C)OOC(=O)C=C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FO3Si/c1-5-6-11-21(3,4)20-19-16(18)12-13(2)14-7-9-15(17)10-8-14/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | JFAICRVKCSLWFW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate?
The IUPAC name of [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate (CID 123421345) is [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate.
What is the SMILES notation for [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate?
The canonical SMILES for [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate is CCCC[Si](C)(C)OOC(=O)C=C(C)c1ccc(F)cc1.
What is the InChIKey of [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate?
The InChIKey is JFAICRVKCSLWFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23FO3Si/c1-5-6-11-21(3,4)20-19-16(18)12-13(2)14-7-9-15(17)10-8-14/h7-10,12H,5-6,11H2,1-4H3.
What are the key properties of [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate?
[butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate has a molecular weight of 310.44 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl(dimethyl)silyl] 3-(4-fluorophenyl)but-2-eneperoxoate is sourced from PubChem (CID 123421345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).