About 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate
1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate (PubChem CID 171623375) has the molecular formula C24H27F2NO3
and a molecular weight of 415.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate |
| PubChem CID | 171623375 |
| Molecular Formula | C24H27F2NO3 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate |
| SMILES | C/C(=C\N=C(/C)C(=O)c1ccc(F)cc1)c1ccc(F)cc1.CCCCC(=O)OC |
| InChI | InChI=1S/C18H15F2NO.C6H12O2/c1-12(14-3-7-16(19)8-4-14)11-21-13(2)18(22)15-5-9-17(20)10-6-15;1-3-4-5-6(7)8-2/h3-11H,1-2H3;3-5H2,1-2H3/b12-11+,21-13+; |
| InChIKey | WRYSEGMATIXCBA-FJXUKPBJSA-N |
| XLogP | 6.02 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate?
The IUPAC name of 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate (CID 171623375) is 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate.
What is the SMILES notation for 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate?
The canonical SMILES for 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate is C/C(=C\N=C(/C)C(=O)c1ccc(F)cc1)c1ccc(F)cc1.CCCCC(=O)OC.
What is the InChIKey of 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate?
The InChIKey is WRYSEGMATIXCBA-FJXUKPBJSA-N. The full InChI is InChI=1S/C18H15F2NO.C6H12O2/c1-12(14-3-7-16(19)8-4-14)11-21-13(2)18(22)15-5-9-17(20)10-6-15;1-3-4-5-6(7)8-2/h3-11H,1-2H3;3-5H2,1-2H3/b12-11+,21-13+;.
What are the key properties of 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate?
1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate has a molecular weight of 415.48 g/mol, XLogP of 6.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-2-[(E)-2-(4-fluorophenyl)prop-1-enyl]iminopropan-1-one;methyl pentanoate is sourced from PubChem (CID 171623375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).