C18H19FN2O2 — CID 56528820
[(1R,2R)-2-pyrazol-1-ylcyclopentyl] (Z)-3-(4-fluorophenyl)but-2-enoate (PubChem CID 56528820) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is [(1R,2R)-2-pyrazol-1-ylcyclopentyl] (Z)-3-(4-fluorophenyl)but-2-enoate.
| Compound Name | [(1R,2R)-2-pyrazol-1-ylcyclopentyl] (Z)-3-(4-fluorophenyl)but-2-enoate |
|---|---|
| PubChem CID | 56528820 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(1R,2R)-2-pyrazol-1-ylcyclopentyl] (Z)-3-(4-fluorophenyl)but-2-enoate |
| SMILES | C/C(=C/C(=O)O[C@@H]1CCC[C@H]1n1cccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN2O2/c1-13(14-6-8-15(19)9-7-14)12-18(22)23-17-5-2-4-16(17)21-11-3-10-20-21/h3,6-12,16-17H,2,4-5H2,1H3/b13-12-/t16-,17-/m1/s1 |
| InChIKey | VJJQVMSCMZXBJC-DQNIMJPHSA-N |
| XLogP | 3.76 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|