C17H22FNO — CID 100850116
(E)-3-(4-fluorophenyl)-N-[(1R,3R)-3-methylcyclohexyl]but-2-enamide (PubChem CID 100850116) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[(1R,3R)-3-methylcyclohexyl]but-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[(1R,3R)-3-methylcyclohexyl]but-2-enamide |
|---|---|
| PubChem CID | 100850116 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[(1R,3R)-3-methylcyclohexyl]but-2-enamide |
| SMILES | C/C(=C\C(=O)N[C@@H]1CCC[C@@H](C)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO/c1-12-4-3-5-16(10-12)19-17(20)11-13(2)14-6-8-15(18)9-7-14/h6-9,11-12,16H,3-5,10H2,1-2H3,(H,19,20)/b13-11+/t12-,16-/m1/s1 |
| InChIKey | BGRXYDMSYOMQSG-LXEKJOJESA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|