C19H26FNO2 — CID 60582793
4-(4-fluorophenyl)-N-(3-methylcyclohexyl)oxane-4-carboxamide (PubChem CID 60582793) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-methylcyclohexyl)oxane-4-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-methylcyclohexyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 60582793 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-methylcyclohexyl)oxane-4-carboxamide |
| SMILES | CC1CCCC(NC(=O)C2(c3ccc(F)cc3)CCOCC2)C1 |
| InChI | InChI=1S/C19H26FNO2/c1-14-3-2-4-17(13-14)21-18(22)19(9-11-23-12-10-19)15-5-7-16(20)8-6-15/h5-8,14,17H,2-4,9-13H2,1H3,(H,21,22) |
| InChIKey | SOFWMOUXJREWFN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |