C22H31FN2O2 — CID 126789566
N-(1-cyclopentylpiperidin-4-yl)-4-(4-fluorophenyl)oxane-4-carboxamide (PubChem CID 126789566) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is N-(1-cyclopentylpiperidin-4-yl)-4-(4-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-(1-cyclopentylpiperidin-4-yl)-4-(4-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 126789566 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-(1-cyclopentylpiperidin-4-yl)-4-(4-fluorophenyl)oxane-4-carboxamide |
| SMILES | O=C(NC1CCN(C2CCCC2)CC1)C1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C22H31FN2O2/c23-18-7-5-17(6-8-18)22(11-15-27-16-12-22)21(26)24-19-9-13-25(14-10-19)20-3-1-2-4-20/h5-8,19-20H,1-4,9-16H2,(H,24,26) |
| InChIKey | IOZZFKIGUYFUTK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |