C19H27FN2O2 — CID 95161026
N-[(3S)-1-ethylpiperidin-3-yl]-4-(4-fluorophenyl)oxane-4-carboxamide (PubChem CID 95161026) has the molecular formula C19H27FN2O2 and a molecular weight of 334.43 g/mol. Its IUPAC name is N-[(3S)-1-ethylpiperidin-3-yl]-4-(4-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-[(3S)-1-ethylpiperidin-3-yl]-4-(4-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 95161026 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[(3S)-1-ethylpiperidin-3-yl]-4-(4-fluorophenyl)oxane-4-carboxamide |
| SMILES | CCN1CCC[C@H](NC(=O)C2(c3ccc(F)cc3)CCOCC2)C1 |
| InChI | InChI=1S/C19H27FN2O2/c1-2-22-11-3-4-17(14-22)21-18(23)19(9-12-24-13-10-19)15-5-7-16(20)8-6-15/h5-8,17H,2-4,9-14H2,1H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | HYLIKGDXGVVXAY-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |