C15H23FO4 — CID 123421424
1-[(3-fluoro-3,4-dimethyloxetan-2-yl)oxymethyl]-5,6-dimethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 123421424) has the molecular formula C15H23FO4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-[(3-fluoro-3,4-dimethyloxetan-2-yl)oxymethyl]-5,6-dimethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
| Compound Name | 1-[(3-fluoro-3,4-dimethyloxetan-2-yl)oxymethyl]-5,6-dimethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 123421424 |
| Molecular Formula | C15H23FO4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 1-[(3-fluoro-3,4-dimethyloxetan-2-yl)oxymethyl]-5,6-dimethyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
| SMILES | CC1CC2C(=O)OC(COC3OC(C)C3(C)F)C2C1C |
| InChI | InChI=1S/C15H23FO4/c1-7-5-10-12(8(7)2)11(20-13(10)17)6-18-14-15(4,16)9(3)19-14/h7-12,14H,5-6H2,1-4H3 |
| InChIKey | LQFLYDZVASKURN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |