C15H26O6 — CID 10040592
(1R,3aS,5R,6aR)-5-(2-methoxyethoxymethoxy)-1-(3-methoxypropyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 10040592) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1R,3aS,5R,6aR)-5-(2-methoxyethoxymethoxy)-1-(3-methoxypropyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
| Compound Name | (1R,3aS,5R,6aR)-5-(2-methoxyethoxymethoxy)-1-(3-methoxypropyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 10040592 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1R,3aS,5R,6aR)-5-(2-methoxyethoxymethoxy)-1-(3-methoxypropyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
| SMILES | COCCC[C@H]1OC(=O)[C@H]2C[C@H](OCOCCOC)C[C@H]21 |
| InChI | InChI=1S/C15H26O6/c1-17-5-3-4-14-12-8-11(9-13(12)15(16)21-14)20-10-19-7-6-18-2/h11-14H,3-10H2,1-2H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | IBYZDNNVHMYCTL-YIYPIFLZSA-N |
| XLogP | 1.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|