C14H22O4 — CID 56595625
(3aS,6R,6aR)-6a-(1,3-dioxolan-2-ylmethyl)-3,3,6-trimethyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one (PubChem CID 56595625) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3aS,6R,6aR)-6a-(1,3-dioxolan-2-ylmethyl)-3,3,6-trimethyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one.
| Compound Name | (3aS,6R,6aR)-6a-(1,3-dioxolan-2-ylmethyl)-3,3,6-trimethyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one |
|---|---|
| PubChem CID | 56595625 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3aS,6R,6aR)-6a-(1,3-dioxolan-2-ylmethyl)-3,3,6-trimethyl-3a,4,5,6-tetrahydrocyclopenta[c]furan-1-one |
| SMILES | C[C@@H]1CC[C@@H]2C(C)(C)OC(=O)[C@]12CC1OCCO1 |
| InChI | InChI=1S/C14H22O4/c1-9-4-5-10-13(2,3)18-12(15)14(9,10)8-11-16-6-7-17-11/h9-11H,4-8H2,1-3H3/t9-,10-,14-/m1/s1 |
| InChIKey | UWGSZHVCXDNLPD-GPCCPHFNSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |