C16H26O6 — CID 11067004
ethyl 2-[(1R,2S,4S,6S,7R,8S,10R)-4,8-diethoxy-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate (PubChem CID 11067004) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,4S,6S,7R,8S,10R)-4,8-diethoxy-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,4S,6S,7R,8S,10R)-4,8-diethoxy-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate |
|---|---|
| PubChem CID | 11067004 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethyl 2-[(1R,2S,4S,6S,7R,8S,10R)-4,8-diethoxy-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2O[C@H](OCC)[C@@H]1[C@@H]1C[C@@H](OCC)O[C@@H]12 |
| InChI | InChI=1S/C16H26O6/c1-4-18-11(17)7-9-13-10-8-12(19-5-2)21-14(10)15(9)22-16(13)20-6-3/h9-10,12-16H,4-8H2,1-3H3/t9-,10+,12+,13+,14+,15-,16+/m1/s1 |
| InChIKey | UXEIZWWIUHDIAL-MWXZLNEISA-N |
| XLogP | 1.71 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |