About ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate
ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate (PubChem CID 137454428) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate.
Analyze ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate?
The IUPAC name of ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate (CID 137454428) is ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate.
What is the SMILES notation for ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate?
The canonical SMILES for ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate is CCOC(=O)CC1NN(C)C(C)O1.
What is the InChIKey of ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate?
The InChIKey is GJKNFTBNANNTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3/c1-4-12-8(11)5-7-9-10(3)6(2)13-7/h6-7,9H,4-5H2,1-3H3.
What are the key properties of ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate?
ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate has a molecular weight of 188.23 g/mol, XLogP of 0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-dimethyl-1,3,4-oxadiazolidin-2-yl)acetate is sourced from PubChem (CID 137454428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).