About ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate
ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate (PubChem CID 163879757) has the molecular formula C7H16N4O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate |
| PubChem CID | 163879757 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate |
| SMILES | CCOC(=O)CC1NN(C)N(C)N1 |
| InChI | InChI=1S/C7H16N4O2/c1-4-13-7(12)5-6-8-10(2)11(3)9-6/h6,8-9H,4-5H2,1-3H3 |
| InChIKey | PSCOATRSLSYCQT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate?
The IUPAC name of ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate (CID 163879757) is ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate.
What is the SMILES notation for ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate?
The canonical SMILES for ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate is CCOC(=O)CC1NN(C)N(C)N1.
What is the InChIKey of ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate?
The InChIKey is PSCOATRSLSYCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O2/c1-4-13-7(12)5-6-8-10(2)11(3)9-6/h6,8-9H,4-5H2,1-3H3.
What are the key properties of ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate?
ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate has a molecular weight of 188.23 g/mol, XLogP of -0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,3-dimethyltetrazolidin-5-yl)acetate is sourced from PubChem (CID 163879757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).