C14H20O6 — CID 10934959
ethyl 2-[(1R,2S,6S,7R,10R)-4-ethoxy-8-oxo-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate (PubChem CID 10934959) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,6S,7R,10R)-4-ethoxy-8-oxo-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,6S,7R,10R)-4-ethoxy-8-oxo-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate |
|---|---|
| PubChem CID | 10934959 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl 2-[(1R,2S,6S,7R,10R)-4-ethoxy-8-oxo-3,9-dioxatricyclo[5.2.1.02,6]decan-10-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2OC(=O)[C@@H]1[C@@H]1CC(OCC)O[C@@H]12 |
| InChI | InChI=1S/C14H20O6/c1-3-17-9(15)5-7-11-8-6-10(18-4-2)19-12(8)13(7)20-14(11)16/h7-8,10-13H,3-6H2,1-2H3/t7-,8+,10?,11+,12+,13-/m1/s1 |
| InChIKey | PFXASODSJRKCSI-DNMOFNIHSA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |