C19H30O6 — CID 139192084
dimethyl (1R,2R,6S,7S,8S,9S)-4-heptyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylate (PubChem CID 139192084) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is dimethyl (1R,2R,6S,7S,8S,9S)-4-heptyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylate.
| Compound Name | dimethyl (1R,2R,6S,7S,8S,9S)-4-heptyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 139192084 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | dimethyl (1R,2R,6S,7S,8S,9S)-4-heptyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8,9-dicarboxylate |
| SMILES | CCCCCCCC1O[C@@H]2[C@@H]3C[C@H]([C@@H]2O1)[C@H](C(=O)OC)[C@H]3C(=O)OC |
| InChI | InChI=1S/C19H30O6/c1-4-5-6-7-8-9-13-24-16-11-10-12(17(16)25-13)15(19(21)23-3)14(11)18(20)22-2/h11-17H,4-10H2,1-3H3/t11-,12+,13?,14-,15-,16-,17+/m0/s1 |
| InChIKey | LTXTVDZWEPWOGN-JDVSOLJBSA-N |
| XLogP | 2.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|