C11H16O5 — CID 22085168
4-(1,3-dioxolan-2-yl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 22085168) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | 4-(1,3-dioxolan-2-yl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 22085168 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | COC1CC2OC(=O)CC2C1C1OCCO1 |
| InChI | InChI=1S/C11H16O5/c1-13-8-5-7-6(4-9(12)16-7)10(8)11-14-2-3-15-11/h6-8,10-11H,2-5H2,1H3 |
| InChIKey | NLFRMRTYEUIERH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |