C11H16O4 — CID 59909458
(3aR,4S,5R)-4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59909458) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3aR,4S,5R)-4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R)-4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59909458 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3aR,4S,5R)-4-(1,3-dioxolan-2-yl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C[C@@H]1CC2OC(=O)C[C@@H]2[C@H]1C1OCCO1 |
| InChI | InChI=1S/C11H16O4/c1-6-4-8-7(5-9(12)15-8)10(6)11-13-2-3-14-11/h6-8,10-11H,2-5H2,1H3/t6-,7+,8?,10+/m1/s1 |
| InChIKey | OLZURAFOOGAKJC-ABFRNEGJSA-N |
| XLogP | 0.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |