C17H28O5 — CID 138984492
ethyl 2-[(1R,4S,5S,8S)-10-ethoxy-6,6-dimethyl-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate (PubChem CID 138984492) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 2-[(1R,4S,5S,8S)-10-ethoxy-6,6-dimethyl-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,4S,5S,8S)-10-ethoxy-6,6-dimethyl-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate |
|---|---|
| PubChem CID | 138984492 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | ethyl 2-[(1R,4S,5S,8S)-10-ethoxy-6,6-dimethyl-3,9-dioxatricyclo[6.3.0.01,5]undecan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1OC[C@]23CC(OCC)O[C@H]2CC(C)(C)[C@H]13 |
| InChI | InChI=1S/C17H28O5/c1-5-19-13(18)7-11-15-16(3,4)8-12-17(15,10-21-11)9-14(22-12)20-6-2/h11-12,14-15H,5-10H2,1-4H3/t11-,12-,14?,15-,17+/m0/s1 |
| InChIKey | MZWZVPNPJXJHKS-XUWGBDFTSA-N |
| XLogP | 2.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |