C16H28O5 — CID 16664648
methyl 2-[(3aR,5R,6R,6aR)-5-hexyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 16664648) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 2-[(3aR,5R,6R,6aR)-5-hexyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,5R,6R,6aR)-5-hexyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 16664648 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | methyl 2-[(3aR,5R,6R,6aR)-5-hexyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCCCCC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C16H28O5/c1-5-6-7-8-9-12-11(10-13(17)18-4)14-15(19-12)21-16(2,3)20-14/h11-12,14-15H,5-10H2,1-4H3/t11-,12-,14-,15-/m1/s1 |
| InChIKey | UJPKRYFVUYAIDP-QHSBEEBCSA-N |
| XLogP | 3.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|