C14H22O4 — CID 10879653
(3aR,4S,6aR)-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione (PubChem CID 10879653) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione.
| Compound Name | (3aR,4S,6aR)-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
|---|---|
| PubChem CID | 10879653 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3aR,4S,6aR)-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
| SMILES | CCCCCCCC[C@@H]1OC(=O)[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C14H22O4/c1-2-3-4-5-6-7-8-11-10-9-12(15)18-13(10)14(16)17-11/h10-11,13H,2-9H2,1H3/t10-,11+,13-/m1/s1 |
| InChIKey | WRJLHIKDTDUDIM-NTZNESFSSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|