C14H22O8 — CID 540044
dimethyl 2-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl]propanedioate (PubChem CID 540044) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is dimethyl 2-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 540044 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | dimethyl 2-[(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methyl]propanedioate |
| SMILES | COC(=O)C(CC1OC(OC)C2OC(C)(C)OC12)C(=O)OC |
| InChI | InChI=1S/C14H22O8/c1-14(2)21-9-8(20-13(19-5)10(9)22-14)6-7(11(15)17-3)12(16)18-4/h7-10,13H,6H2,1-5H3 |
| InChIKey | MOHJGBOQBJHDNZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|