C17H30O5 — CID 16664773
methyl 2-[(3aR,5R,6R,6aR)-5-heptyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate (PubChem CID 16664773) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is methyl 2-[(3aR,5R,6R,6aR)-5-heptyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,5R,6R,6aR)-5-heptyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 16664773 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | methyl 2-[(3aR,5R,6R,6aR)-5-heptyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]acetate |
| SMILES | CCCCCCC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C17H30O5/c1-5-6-7-8-9-10-13-12(11-14(18)19-4)15-16(20-13)22-17(2,3)21-15/h12-13,15-16H,5-11H2,1-4H3/t12-,13-,15-,16-/m1/s1 |
| InChIKey | IKIXCKPQFWMVLE-RRCSTGOVSA-N |
| XLogP | 3.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|