C14H22O5 — CID 11011055
[(3aR,4S,5S,6aR)-3-methoxy-3a-methyl-4-(2-oxopropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl] acetate (PubChem CID 11011055) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is [(3aR,4S,5S,6aR)-3-methoxy-3a-methyl-4-(2-oxopropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl] acetate.
| Compound Name | [(3aR,4S,5S,6aR)-3-methoxy-3a-methyl-4-(2-oxopropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl] acetate |
|---|---|
| PubChem CID | 11011055 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(3aR,4S,5S,6aR)-3-methoxy-3a-methyl-4-(2-oxopropyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]furan-5-yl] acetate |
| SMILES | COC1OC[C@@H]2C[C@H](OC(C)=O)[C@@H](CC(C)=O)[C@]12C |
| InChI | InChI=1S/C14H22O5/c1-8(15)5-11-12(19-9(2)16)6-10-7-18-13(17-4)14(10,11)3/h10-13H,5-7H2,1-4H3/t10-,11+,12-,13?,14+/m0/s1 |
| InChIKey | BXJRPWSWJUIYKY-QKKUGOMVSA-N |
| XLogP | 1.54 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |