C23H32N4O5 — CID 123424906
(2,5-dihydroxypyrrol-1-yl) 4-[(4-morpholin-4-yl-2-propan-2-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 123424906) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[(4-morpholin-4-yl-2-propan-2-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[(4-morpholin-4-yl-2-propan-2-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123424906 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[(4-morpholin-4-yl-2-propan-2-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)c1cc(N2CCOCC2)ccc1CN1CCN(C(=O)On2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C23H32N4O5/c1-17(2)20-15-19(25-11-13-31-14-12-25)4-3-18(20)16-24-7-9-26(10-8-24)23(30)32-27-21(28)5-6-22(27)29/h3-6,15,17,28-29H,7-14,16H2,1-2H3 |
| InChIKey | JMGWFROUTXFUST-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|