C31H25N5O3S — CID 123425332
10-[3-[5-[[hydroxy(1H-indol-2-yl)methyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-3-methyl-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 123425332) has the molecular formula C31H25N5O3S and a molecular weight of 547.64 g/mol. Its IUPAC name is 10-[3-[5-[[hydroxy(1H-indol-2-yl)methyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-3-methyl-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | 10-[3-[5-[[hydroxy(1H-indol-2-yl)methyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-3-methyl-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 123425332 |
| Molecular Formula | C31H25N5O3S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 10-[3-[5-[[hydroxy(1H-indol-2-yl)methyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enoyl]-3-methyl-5-thia-10-azatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | Cc1csc2c1C13CC1CN(C(=O)C=Cc1c[nH]c4ncc(NC(O)c5cc6ccccc6[nH]5)cc14)C3=CC2=O |
| InChI | InChI=1S/C31H25N5O3S/c1-16-15-40-28-24(37)10-25-31(27(16)28)11-19(31)14-36(25)26(38)7-6-18-12-32-29-21(18)9-20(13-33-29)34-30(39)23-8-17-4-2-3-5-22(17)35-23/h2-10,12-13,15,19,30,34-35,39H,11,14H2,1H3,(H,32,33) |
| InChIKey | SJXNQYCVRVMTAU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|