C27H32FN3O2 — CID 123426058
3-(2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-8-(3-fluoro-4-methoxyphenyl)-9-methyl-9,10-dihydropyrido[1,2-a]azocin-6-one (PubChem CID 123426058) has the molecular formula C27H32FN3O2 and a molecular weight of 449.57 g/mol. Its IUPAC name is 3-(2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-8-(3-fluoro-4-methoxyphenyl)-9-methyl-9,10-dihydropyrido[1,2-a]azocin-6-one.
| Compound Name | 3-(2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-8-(3-fluoro-4-methoxyphenyl)-9-methyl-9,10-dihydropyrido[1,2-a]azocin-6-one |
|---|---|
| PubChem CID | 123426058 |
| Molecular Formula | C27H32FN3O2 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 3-(2-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-8-(3-fluoro-4-methoxyphenyl)-9-methyl-9,10-dihydropyrido[1,2-a]azocin-6-one |
| SMILES | CCN1CC2CN(C3=CN4C(=O)C=C(c5ccc(OC)c(F)c5)C(C)CC=C4C=C3)CC2C1 |
| InChI | InChI=1S/C27H32FN3O2/c1-4-29-13-20-15-30(16-21(20)14-29)23-9-8-22-7-5-18(2)24(12-27(32)31(22)17-23)19-6-10-26(33-3)25(28)11-19/h6-12,17-18,20-21H,4-5,13-16H2,1-3H3 |
| InChIKey | YSOGYCCQHUVNDK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |