C25H28N2O3 — CID 123498856
8-(3,4-dimethoxyphenyl)-9-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)-9,10-dihydropyrido[1,2-a]azocin-6-one (PubChem CID 123498856) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-9-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)-9,10-dihydropyrido[1,2-a]azocin-6-one.
| Compound Name | 8-(3,4-dimethoxyphenyl)-9-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)-9,10-dihydropyrido[1,2-a]azocin-6-one |
|---|---|
| PubChem CID | 123498856 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-9-methyl-3-(1,2,3,6-tetrahydropyridin-5-yl)-9,10-dihydropyrido[1,2-a]azocin-6-one |
| SMILES | COc1ccc(C2=CC(=O)N3C=C(C4=CCCNC4)C=CC3=CCC2C)cc1OC |
| InChI | InChI=1S/C25H28N2O3/c1-17-6-9-21-10-7-20(19-5-4-12-26-15-19)16-27(21)25(28)14-22(17)18-8-11-23(29-2)24(13-18)30-3/h5,7-11,13-14,16-17,26H,4,6,12,15H2,1-3H3 |
| InChIKey | NHZAOTNEAHBDBJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |