C22H25N2O2P — CID 144885512
2-(4-methoxy-3-methylphenyl)-9-methyl-7-(1,2,3,6-tetrahydropyridin-4-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one (PubChem CID 144885512) has the molecular formula C22H25N2O2P and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)-9-methyl-7-(1,2,3,6-tetrahydropyridin-4-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one.
| Compound Name | 2-(4-methoxy-3-methylphenyl)-9-methyl-7-(1,2,3,6-tetrahydropyridin-4-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
|---|---|
| PubChem CID | 144885512 |
| Molecular Formula | C22H25N2O2P |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)-9-methyl-7-(1,2,3,6-tetrahydropyridin-4-yl)-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
| SMILES | COc1ccc(C2=CC(=O)N3C=C(C4=CCNCC4)C=C(C)C3P2)cc1C |
| InChI | InChI=1S/C22H25N2O2P/c1-14-10-17(4-5-19(14)26-3)20-12-21(25)24-13-18(11-15(2)22(24)27-20)16-6-8-23-9-7-16/h4-6,10-13,22-23,27H,7-9H2,1-3H3 |
| InChIKey | GOOJOUVAIANXAL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|