C20H27NO — CID 123426295
N-cyclopropyl-2-methyl-4-(5-methylocta-3,7-dien-3-yl)benzamide (PubChem CID 123426295) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-4-(5-methylocta-3,7-dien-3-yl)benzamide.
| Compound Name | N-cyclopropyl-2-methyl-4-(5-methylocta-3,7-dien-3-yl)benzamide |
|---|---|
| PubChem CID | 123426295 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-cyclopropyl-2-methyl-4-(5-methylocta-3,7-dien-3-yl)benzamide |
| SMILES | C=CCC(C)C=C(CC)c1ccc(C(=O)NC2CC2)c(C)c1 |
| InChI | InChI=1S/C20H27NO/c1-5-7-14(3)12-16(6-2)17-8-11-19(15(4)13-17)20(22)21-18-9-10-18/h5,8,11-14,18H,1,6-7,9-10H2,2-4H3,(H,21,22) |
| InChIKey | WGSCZPAMIOOWTB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|