C18H22N3O4S+ — CID 123428255
2-[2-(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)ethylsulfinyl]-6-methoxy-1H-benzimidazole (PubChem CID 123428255) has the molecular formula C18H22N3O4S+ and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[2-(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)ethylsulfinyl]-6-methoxy-1H-benzimidazole.
| Compound Name | 2-[2-(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)ethylsulfinyl]-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 123428255 |
| Molecular Formula | C18H22N3O4S+ |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-[2-(1-hydroxy-4-methoxy-3,5-dimethylpyridin-1-ium-2-yl)ethylsulfinyl]-6-methoxy-1H-benzimidazole |
| SMILES | COc1ccc2nc(S(=O)CCc3c(C)c(OC)c(C)c[n+]3O)[nH]c2c1 |
| InChI | InChI=1S/C18H22N3O4S/c1-11-10-21(22)16(12(2)17(11)25-4)7-8-26(23)18-19-14-6-5-13(24-3)9-15(14)20-18/h5-6,9-10,22H,7-8H2,1-4H3,(H,19,20)/q+1 |
| InChIKey | RRRCYNMJVOIOTI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|