C16H18N3O3S+ — CID 156613626
2-(2-hydroxysulfanyl-4-methoxy-3,5-dimethylpyridin-1-ium-1-yl)-6-methoxy-1H-benzimidazole (PubChem CID 156613626) has the molecular formula C16H18N3O3S+ and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-(2-hydroxysulfanyl-4-methoxy-3,5-dimethylpyridin-1-ium-1-yl)-6-methoxy-1H-benzimidazole.
| Compound Name | 2-(2-hydroxysulfanyl-4-methoxy-3,5-dimethylpyridin-1-ium-1-yl)-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 156613626 |
| Molecular Formula | C16H18N3O3S+ |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-(2-hydroxysulfanyl-4-methoxy-3,5-dimethylpyridin-1-ium-1-yl)-6-methoxy-1H-benzimidazole |
| SMILES | COc1ccc2nc(-[n+]3cc(C)c(OC)c(C)c3SO)[nH]c2c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-9-8-19(15(23-20)10(2)14(9)22-4)16-17-12-6-5-11(21-3)7-13(12)18-16/h5-8H,1-4H3,(H-,17,18,20)/p+1 |
| InChIKey | WMVXSZYPWDNNHS-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|