C19H24N3O2S+ — CID 123554060
2-[4-ethyl-2-(hydroxysulfanylmethyl)-3,5,6-trimethylpyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole (PubChem CID 123554060) has the molecular formula C19H24N3O2S+ and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[4-ethyl-2-(hydroxysulfanylmethyl)-3,5,6-trimethylpyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole.
| Compound Name | 2-[4-ethyl-2-(hydroxysulfanylmethyl)-3,5,6-trimethylpyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 123554060 |
| Molecular Formula | C19H24N3O2S+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[4-ethyl-2-(hydroxysulfanylmethyl)-3,5,6-trimethylpyridin-1-ium-1-yl]-6-methoxy-1H-benzimidazole |
| SMILES | CCc1c(C)c(C)[n+](-c2nc3ccc(OC)cc3[nH]2)c(CSO)c1C |
| InChI | InChI=1S/C19H23N3O2S/c1-6-15-11(2)13(4)22(18(10-25-23)12(15)3)19-20-16-8-7-14(24-5)9-17(16)21-19/h7-9H,6,10H2,1-5H3,(H-,20,21,23)/p+1 |
| InChIKey | OZJBSBKVMDIKFA-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|