C15H20N2O3S — CID 79004757
ethyl 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pentanoate (PubChem CID 79004757) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pentanoate.
| Compound Name | ethyl 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pentanoate |
|---|---|
| PubChem CID | 79004757 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | ethyl 2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pentanoate |
| SMILES | CCCC(Sc1nc2ccc(OC)cc2[nH]1)C(=O)OCC |
| InChI | InChI=1S/C15H20N2O3S/c1-4-6-13(14(18)20-5-2)21-15-16-11-8-7-10(19-3)9-12(11)17-15/h7-9,13H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | CTCKBUILQIPDRR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |