C19H24ClN3O3S2 — CID 10575173
2-[[4-methoxy-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethylpyridin-1-ium-2-yl]methyldisulfanyl]ethanol chloride (PubChem CID 10575173) has the molecular formula C19H24ClN3O3S2 and a molecular weight of 442.01 g/mol. Its IUPAC name is 2-[[4-methoxy-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethylpyridin-1-ium-2-yl]methyldisulfanyl]ethanol chloride.
| Compound Name | 2-[[4-methoxy-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethylpyridin-1-ium-2-yl]methyldisulfanyl]ethanol chloride |
|---|---|
| PubChem CID | 10575173 |
| Molecular Formula | C19H24ClN3O3S2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[[4-methoxy-1-(6-methoxy-1H-benzimidazol-2-yl)-3,5-dimethylpyridin-1-ium-2-yl]methyldisulfanyl]ethanol chloride |
| SMILES | COc1ccc2nc(-[n+]3cc(C)c(OC)c(C)c3CSSCCO)[nH]c2c1.[Cl-] |
| InChI | InChI=1S/C19H24N3O3S2.ClH/c1-12-10-22(17(11-27-26-8-7-23)13(2)18(12)25-4)19-20-15-6-5-14(24-3)9-16(15)21-19;/h5-6,9-10,23H,7-8,11H2,1-4H3,(H,20,21);1H/q+1;/p-1 |
| InChIKey | UJUNNSONOVTREX-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|