C19H21F3N3OS2+ — CID 3079141
2-[4-methoxy-3-methyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 3079141) has the molecular formula C19H21F3N3OS2+ and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[4-methoxy-3-methyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-[4-methoxy-3-methyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 3079141 |
| Molecular Formula | C19H21F3N3OS2+ |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[4-methoxy-3-methyl-2-[(propyldisulfanyl)methyl]pyridin-1-ium-1-yl]-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | CCCSSCc1c(C)c(OC)cc[n+]1-c1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C19H21F3N3OS2/c1-4-9-27-28-11-16-12(2)17(26-3)7-8-25(16)18-23-14-6-5-13(19(20,21)22)10-15(14)24-18/h5-8,10H,4,9,11H2,1-3H3,(H,23,24)/q+1 |
| InChIKey | LSXWLQKERXDIAI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|