C27H36ClN3O2S2 — CID 21295917
2-[4-methoxy-3-methyl-2-[(pentyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride (PubChem CID 21295917) has the molecular formula C27H36ClN3O2S2 and a molecular weight of 534.19 g/mol. Its IUPAC name is 2-[4-methoxy-3-methyl-2-[(pentyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride.
| Compound Name | 2-[4-methoxy-3-methyl-2-[(pentyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride |
|---|---|
| PubChem CID | 21295917 |
| Molecular Formula | C27H36ClN3O2S2 |
| Molecular Weight | 534.19 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 2-[4-methoxy-3-methyl-2-[(pentyldisulfanyl)methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride |
| SMILES | CCCCCSSCc1c(C)c(OC)cc[n+]1-c1nc2cc3c(cc2[nH]1)C(C)(C)C(=O)C3(C)C.[Cl-] |
| InChI | InChI=1S/C27H36N3O2S2.ClH/c1-8-9-10-13-33-34-16-22-17(2)23(32-7)11-12-30(22)25-28-20-14-18-19(15-21(20)29-25)27(5,6)24(31)26(18,3)4;/h11-12,14-15H,8-10,13,16H2,1-7H3,(H,28,29);1H/q+1;/p-1 |
| InChIKey | NBYRYFMVBYOWNK-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|