C29H31ClN4O4S2 — CID 21296016
2-[4-methoxy-3-methyl-2-[[(3-nitrophenyl)methyldisulfanyl]methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride (PubChem CID 21296016) has the molecular formula C29H31ClN4O4S2 and a molecular weight of 599.18 g/mol. Its IUPAC name is 2-[4-methoxy-3-methyl-2-[[(3-nitrophenyl)methyldisulfanyl]methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride.
| Compound Name | 2-[4-methoxy-3-methyl-2-[[(3-nitrophenyl)methyldisulfanyl]methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride |
|---|---|
| PubChem CID | 21296016 |
| Molecular Formula | C29H31ClN4O4S2 |
| Molecular Weight | 599.18 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 2-[4-methoxy-3-methyl-2-[[(3-nitrophenyl)methyldisulfanyl]methyl]pyridin-1-ium-1-yl]-5,5,7,7-tetramethyl-3H-cyclopenta[f]benzimidazol-6-one chloride |
| SMILES | COc1cc[n+](-c2nc3cc4c(cc3[nH]2)C(C)(C)C(=O)C4(C)C)c(CSSCc2cccc([N+](=O)[O-])c2)c1C.[Cl-] |
| InChI | InChI=1S/C29H31N4O4S2.ClH/c1-17-24(16-39-38-15-18-8-7-9-19(12-18)33(35)36)32(11-10-25(17)37-6)27-30-22-13-20-21(14-23(22)31-27)29(4,5)26(34)28(20,2)3;/h7-14H,15-16H2,1-6H3,(H,30,31);1H/q+1;/p-1 |
| InChIKey | MQJHOCCRYURKKB-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|