C25H30N3O4S2+ — CID 21295976
2-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoic acid (PubChem CID 21295976) has the molecular formula C25H30N3O4S2+ and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoic acid.
| Compound Name | 2-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21295976 |
| Molecular Formula | C25H30N3O4S2+ |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 2-[[4-methoxy-3-methyl-1-(5,5,7,7-tetramethyl-6-oxo-3H-cyclopenta[f]benzimidazol-2-yl)pyridin-1-ium-2-yl]methyldisulfanyl]propanoic acid |
| SMILES | COc1cc[n+](-c2nc3cc4c(cc3[nH]2)C(C)(C)C(=O)C4(C)C)c(CSSC(C)C(=O)O)c1C |
| InChI | InChI=1S/C25H29N3O4S2/c1-13-19(12-33-34-14(2)21(29)30)28(9-8-20(13)32-7)23-26-17-10-15-16(11-18(17)27-23)25(5,6)22(31)24(15,3)4/h8-11,14H,12H2,1-7H3,(H-,26,27,29,30)/p+1 |
| InChIKey | BFRUUXJGHRKPKM-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|